7-Chloro-4-quinolinamine
Catalog No: FT-0633467
CAS No: 1198-40-9
- Chemical Name: 7-Chloro-4-quinolinamine
- Molecular Formula: C9H7ClN2
- Molecular Weight: 178.62
- InChI Key: NDRZSRWMMUGOBP-UHFFFAOYSA-N
- InChI: InChI=1S/C9H7ClN2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H,(H2,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 7-Chloro-4-quinolinamine |
|---|---|
| Bolling_Point: | 366.8±27.0 °C at 760 mmHg |
| MF: | C9H7ClN2 |
| Symbol: | GHS06 |
| Melting_Point: | 96-97°C |
| CAS: | 1198-40-9 |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 178.618 |
| Flash_Point: | 175.7±23.7 °C |
| MF: | C9H7ClN2 |
|---|---|
| Water_Solubility: | REACTS |
| Bolling_Point: | 366.8±27.0 °C at 760 mmHg |
| Exact_Mass: | 178.029770 |
| More_Info: | ['1. Density（g/cm3）1363 ', '2. Boiling point（760 mmHg,ºC）3668 ', '3. Flash point（ºC）1757'] |
| Melting_Point: | 96-97°C |
| PSA: | 38.91000 |
| Flash_Point: | 175.7±23.7 °C |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :3 ', '6. TPSA 389 ', '7. Heavy Atom Count :12 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :163 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Density: | 1.4±0.1 g/cm3 |
| Molecular_Structure: | ['1 . Molar refractive index 5131 ', '2 . Molar volume 1310 ', '3 . Parachor （902K）3669 ', '4 . Surface tension 615 ', '5 . Polarizability 2034'] |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| FW: | 178.618 |
| LogP: | 2.38 |
| Refractive_Index: | 1.712 |
| Risk_Statements(EU): | R34:Causes burns. R40:Limited evidence of a carcinogenic effect. R14:Reacts violently with water. |
|---|---|
| Hazard_Codes: | C |
| RTECS: | RR4584700 |
| HS_Code: | 29420000 |
| Packing_Group: | II |
| WGK_Germany: | 2 |
| Warning_Statement: | P301 + P310-P305 + P351 + P338 |
| Safety_Statements: | H301-H319 |
| Symbol: | GHS06 |
| RIDADR: | UN 3265 8/PG 2 |
| Hazard_Class: | 4.1 |
